About 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide
6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide (PubChem CID 176710619) has the molecular formula C13H9ClN4O2S2
and a molecular weight of 352.83 g/mol. Its IUPAC name is 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide.
Molecular Properties
| Compound Name | 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide |
| PubChem CID | 176710619 |
| Molecular Formula | C13H9ClN4O2S2 |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ncc2sccn12)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C13H9ClN4O2S2/c14-8-1-2-9-10(5-8)15-6-11(9)22(19,20)17-13-16-7-12-18(13)3-4-21-12/h1-7,15H,(H,16,17) |
| InChIKey | LMUHSBGHNNIVFY-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide?
The IUPAC name of 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide (CID 176710619) is 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide.
What is the SMILES notation for 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide?
The canonical SMILES for 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide is O=S(=O)(Nc1ncc2sccn12)c1c[nH]c2cc(Cl)ccc12.
What is the InChIKey of 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide?
The InChIKey is LMUHSBGHNNIVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN4O2S2/c14-8-1-2-9-10(5-8)15-6-11(9)22(19,20)17-13-16-7-12-18(13)3-4-21-12/h1-7,15H,(H,16,17).
What are the key properties of 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide?
6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide has a molecular weight of 352.83 g/mol, XLogP of 3.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-imidazo[5,1-b][1,3]thiazol-5-yl-1H-indole-3-sulfonamide is sourced from PubChem (CID 176710619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).