C22H19ClN4S — CID 142505433
N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 142505433) has the molecular formula C22H19ClN4S and a molecular weight of 406.94 g/mol. Its IUPAC name is N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 142505433 |
| Molecular Formula | C22H19ClN4S |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.10 |
| IUPAC Name | N-[[6-(4-chlorophenyl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | Clc1ccc(-c2nc3sccn3c2CNCCc2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C22H19ClN4S/c23-17-7-5-15(6-8-17)21-20(27-11-12-28-22(27)26-21)14-24-10-9-16-13-25-19-4-2-1-3-18(16)19/h1-8,11-13,24-25H,9-10,14H2 |
| InChIKey | LSIICHRDIJMBGF-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 45.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|