C18H11ClF2N2O2S2 — CID 135201179
N-(4-chloro-2,5-difluorophenyl)-6-thiophen-3-yl-1H-indole-3-sulfonamide (PubChem CID 135201179) has the molecular formula C18H11ClF2N2O2S2 and a molecular weight of 424.88 g/mol. Its IUPAC name is N-(4-chloro-2,5-difluorophenyl)-6-thiophen-3-yl-1H-indole-3-sulfonamide.
| Compound Name | N-(4-chloro-2,5-difluorophenyl)-6-thiophen-3-yl-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135201179 |
| Molecular Formula | C18H11ClF2N2O2S2 |
| Molecular Weight | 424.88 g/mol |
| Exact Mass | 423.99 |
| IUPAC Name | N-(4-chloro-2,5-difluorophenyl)-6-thiophen-3-yl-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1cc(F)c(Cl)cc1F)c1c[nH]c2cc(-c3ccsc3)ccc12 |
| InChI | InChI=1S/C18H11ClF2N2O2S2/c19-13-6-15(21)17(7-14(13)20)23-27(24,25)18-8-22-16-5-10(1-2-12(16)18)11-3-4-26-9-11/h1-9,22-23H |
| InChIKey | NEVNTCZYJYOOQZ-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.88 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|