C18H17ClF2N2O3S — CID 159732808
6-chloro-3-[[5-(2-ethoxyethyl)-3,6-difluoro-2-pyridinyl]methylsulfonyl]-1H-indole (PubChem CID 159732808) has the molecular formula C18H17ClF2N2O3S and a molecular weight of 414.86 g/mol. Its IUPAC name is 6-chloro-3-[[5-(2-ethoxyethyl)-3,6-difluoro-2-pyridinyl]methylsulfonyl]-1H-indole.
| Compound Name | 6-chloro-3-[[5-(2-ethoxyethyl)-3,6-difluoro-2-pyridinyl]methylsulfonyl]-1H-indole |
|---|---|
| PubChem CID | 159732808 |
| Molecular Formula | C18H17ClF2N2O3S |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.06 |
| IUPAC Name | 6-chloro-3-[[5-(2-ethoxyethyl)-3,6-difluoro-2-pyridinyl]methylsulfonyl]-1H-indole |
| SMILES | CCOCCc1cc(F)c(CS(=O)(=O)c2c[nH]c3cc(Cl)ccc23)nc1F |
| InChI | InChI=1S/C18H17ClF2N2O3S/c1-2-26-6-5-11-7-14(20)16(23-18(11)21)10-27(24,25)17-9-22-15-8-12(19)3-4-13(15)17/h3-4,7-9,22H,2,5-6,10H2,1H3 |
| InChIKey | BAKLVYBIZANDTN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|