C14H9ClF2N2O2S — CID 135201009
6-chloro-N-(2,4-difluorophenyl)-1H-indole-3-sulfonamide (PubChem CID 135201009) has the molecular formula C14H9ClF2N2O2S and a molecular weight of 342.75 g/mol. Its IUPAC name is 6-chloro-N-(2,4-difluorophenyl)-1H-indole-3-sulfonamide.
| Compound Name | 6-chloro-N-(2,4-difluorophenyl)-1H-indole-3-sulfonamide |
|---|---|
| PubChem CID | 135201009 |
| Molecular Formula | C14H9ClF2N2O2S |
| Molecular Weight | 342.75 g/mol |
| Exact Mass | 342.00 |
| IUPAC Name | 6-chloro-N-(2,4-difluorophenyl)-1H-indole-3-sulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cc1F)c1c[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C14H9ClF2N2O2S/c15-8-1-3-10-13(5-8)18-7-14(10)22(20,21)19-12-4-2-9(16)6-11(12)17/h1-7,18-19H |
| InChIKey | QBZREYONOLKYBA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.75 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |