C25H29O4P — CID 19357678
3-[hydroxy(naphthalen-2-yl)phosphoryl]-2-phenylnonanoic acid (PubChem CID 19357678) has the molecular formula C25H29O4P and a molecular weight of 424.48 g/mol. Its IUPAC name is 3-[hydroxy(naphthalen-2-yl)phosphoryl]-2-phenylnonanoic acid.
| Compound Name | 3-[hydroxy(naphthalen-2-yl)phosphoryl]-2-phenylnonanoic acid |
|---|---|
| PubChem CID | 19357678 |
| Molecular Formula | C25H29O4P |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | 3-[hydroxy(naphthalen-2-yl)phosphoryl]-2-phenylnonanoic acid |
| SMILES | CCCCCCC(C(C(=O)O)c1ccccc1)P(=O)(O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H29O4P/c1-2-3-4-8-15-23(24(25(26)27)20-12-6-5-7-13-20)30(28,29)22-17-16-19-11-9-10-14-21(19)18-22/h5-7,9-14,16-18,23-24H,2-4,8,15H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | GRDZJWYIBJPBKY-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|