C16H20N2O2 — CID 174526568
(2S)-4-methyl-2-(2-naphthalen-1-ylhydrazinyl)pentanoic acid (PubChem CID 174526568) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-4-methyl-2-(2-naphthalen-1-ylhydrazinyl)pentanoic acid.
| Compound Name | (2S)-4-methyl-2-(2-naphthalen-1-ylhydrazinyl)pentanoic acid |
|---|---|
| PubChem CID | 174526568 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (2S)-4-methyl-2-(2-naphthalen-1-ylhydrazinyl)pentanoic acid |
| SMILES | CC(C)C[C@H](NNc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C16H20N2O2/c1-11(2)10-15(16(19)20)18-17-14-9-5-7-12-6-3-4-8-13(12)14/h3-9,11,15,17-18H,10H2,1-2H3,(H,19,20)/t15-/m0/s1 |
| InChIKey | MAXYUWFTCDWJBJ-HNNXBMFYSA-N |
| XLogP | 3.26 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|