About azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid
azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid (PubChem CID 66694712) has the molecular formula C13H16N2O2
and a molecular weight of 232.28 g/mol. Its IUPAC name is azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid.
Molecular Properties
| Compound Name | azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid |
| PubChem CID | 66694712 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid |
| SMILES | C[C@H](Nc1cccc2ccccc12)C(=O)O.N |
| InChI | InChI=1S/C13H13NO2.H3N/c1-9(13(15)16)14-12-8-4-6-10-5-2-3-7-11(10)12;/h2-9,14H,1H3,(H,15,16);1H3/t9-;/m0./s1 |
| InChIKey | HHGQUXRHZMKDGM-FVGYRXGTSA-N |
| XLogP | 2.89 |
| TPSA | 84.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid?
The IUPAC name of azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid (CID 66694712) is azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid.
What is the SMILES notation for azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid?
The canonical SMILES for azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid is C[C@H](Nc1cccc2ccccc12)C(=O)O.N.
What is the InChIKey of azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid?
The InChIKey is HHGQUXRHZMKDGM-FVGYRXGTSA-N. The full InChI is InChI=1S/C13H13NO2.H3N/c1-9(13(15)16)14-12-8-4-6-10-5-2-3-7-11(10)12;/h2-9,14H,1H3,(H,15,16);1H3/t9-;/m0./s1.
What are the key properties of azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid?
azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid has a molecular weight of 232.28 g/mol, XLogP of 2.89, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;(2S)-2-(naphthalen-1-ylamino)propanoic acid is sourced from PubChem (CID 66694712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).