C17H23O6P — CID 19357761
2-[1-[hydroxy-[(4-methylphenyl)methyl]phosphoryl]but-3-enyl]pentanedioic acid (PubChem CID 19357761) has the molecular formula C17H23O6P and a molecular weight of 354.34 g/mol. Its IUPAC name is 2-[1-[hydroxy-[(4-methylphenyl)methyl]phosphoryl]but-3-enyl]pentanedioic acid.
| Compound Name | 2-[1-[hydroxy-[(4-methylphenyl)methyl]phosphoryl]but-3-enyl]pentanedioic acid |
|---|---|
| PubChem CID | 19357761 |
| Molecular Formula | C17H23O6P |
| Molecular Weight | 354.34 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[1-[hydroxy-[(4-methylphenyl)methyl]phosphoryl]but-3-enyl]pentanedioic acid |
| SMILES | C=CCC(C(CCC(=O)O)C(=O)O)P(=O)(O)Cc1ccc(C)cc1 |
| InChI | InChI=1S/C17H23O6P/c1-3-4-15(14(17(20)21)9-10-16(18)19)24(22,23)11-13-7-5-12(2)6-8-13/h3,5-8,14-15H,1,4,9-11H2,2H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | ZCIUJTQADZXCRD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|