C22H24O4 — CID 89151072
2-[(4-ethenylphenyl)methyl]-3-[2-(4-methylphenyl)ethyl]butanedioic acid (PubChem CID 89151072) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methyl]-3-[2-(4-methylphenyl)ethyl]butanedioic acid.
| Compound Name | 2-[(4-ethenylphenyl)methyl]-3-[2-(4-methylphenyl)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 89151072 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-[(4-ethenylphenyl)methyl]-3-[2-(4-methylphenyl)ethyl]butanedioic acid |
| SMILES | C=Cc1ccc(CC(C(=O)O)C(CCc2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H24O4/c1-3-16-8-10-18(11-9-16)14-20(22(25)26)19(21(23)24)13-12-17-6-4-15(2)5-7-17/h3-11,19-20H,1,12-14H2,2H3,(H,23,24)(H,25,26) |
| InChIKey | MGDCWESOELSRGF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |