C15H18O3 — CID 174620231
2-[(4-ethenylphenyl)methyl]-3-methyl-5-oxopentanoic acid (PubChem CID 174620231) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[(4-ethenylphenyl)methyl]-3-methyl-5-oxopentanoic acid.
| Compound Name | 2-[(4-ethenylphenyl)methyl]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174620231 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 2-[(4-ethenylphenyl)methyl]-3-methyl-5-oxopentanoic acid |
| SMILES | C=Cc1ccc(CC(C(=O)O)C(C)CC=O)cc1 |
| InChI | InChI=1S/C15H18O3/c1-3-12-4-6-13(7-5-12)10-14(15(17)18)11(2)8-9-16/h3-7,9,11,14H,1,8,10H2,2H3,(H,17,18) |
| InChIKey | ZFNKCUIAAWSCJO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|