C18H20 — CID 175031243
1-ethenyl-4-(2-phenylbutyl)benzene (PubChem CID 175031243) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1-ethenyl-4-(2-phenylbutyl)benzene.
| Compound Name | 1-ethenyl-4-(2-phenylbutyl)benzene |
|---|---|
| PubChem CID | 175031243 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1-ethenyl-4-(2-phenylbutyl)benzene |
| SMILES | C=Cc1ccc(CC(CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20/c1-3-15-10-12-16(13-11-15)14-17(4-2)18-8-6-5-7-9-18/h3,5-13,17H,1,4,14H2,2H3 |
| InChIKey | STVRLUJWUXNVAN-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |