About 2-(4-ethenylphenyl)ethane-1,1-diol
2-(4-ethenylphenyl)ethane-1,1-diol (PubChem CID 166912920) has the molecular formula C10H12O2
and a molecular weight of 164.20 g/mol. Its IUPAC name is 2-(4-ethenylphenyl)ethane-1,1-diol.
Molecular Properties
| Compound Name | 2-(4-ethenylphenyl)ethane-1,1-diol |
| PubChem CID | 166912920 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 2-(4-ethenylphenyl)ethane-1,1-diol |
| SMILES | C=Cc1ccc(CC(O)O)cc1 |
| InChI | InChI=1S/C10H12O2/c1-2-8-3-5-9(6-4-8)7-10(11)12/h2-6,10-12H,1,7H2 |
| InChIKey | LYIWSFXJTNTFKR-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-ethenylphenyl)ethane-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-ethenylphenyl)ethane-1,1-diol?
The IUPAC name of 2-(4-ethenylphenyl)ethane-1,1-diol (CID 166912920) is 2-(4-ethenylphenyl)ethane-1,1-diol.
What is the SMILES notation for 2-(4-ethenylphenyl)ethane-1,1-diol?
The canonical SMILES for 2-(4-ethenylphenyl)ethane-1,1-diol is C=Cc1ccc(CC(O)O)cc1.
What is the InChIKey of 2-(4-ethenylphenyl)ethane-1,1-diol?
The InChIKey is LYIWSFXJTNTFKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O2/c1-2-8-3-5-9(6-4-8)7-10(11)12/h2-6,10-12H,1,7H2.
What are the key properties of 2-(4-ethenylphenyl)ethane-1,1-diol?
2-(4-ethenylphenyl)ethane-1,1-diol has a molecular weight of 164.20 g/mol, XLogP of 1.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethenylphenyl)ethane-1,1-diol is sourced from PubChem (CID 166912920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).