C8H9BrO2 — CID 54153595
2-(4-bromophenyl)ethane-1,1-diol (PubChem CID 54153595) has the molecular formula C8H9BrO2 and a molecular weight of 217.06 g/mol. Its IUPAC name is 2-(4-bromophenyl)ethane-1,1-diol.
| Compound Name | 2-(4-bromophenyl)ethane-1,1-diol |
|---|---|
| PubChem CID | 54153595 |
| Molecular Formula | C8H9BrO2 |
| Molecular Weight | 217.06 g/mol |
| Exact Mass | 215.98 |
| IUPAC Name | 2-(4-bromophenyl)ethane-1,1-diol |
| SMILES | OC(O)Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C8H9BrO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4,8,10-11H,5H2 |
| InChIKey | OJLQZHIEFMAESW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.06 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|