C14H11BrCl2O — CID 63518260
2-(4-bromophenyl)-1-(3,5-dichlorophenyl)ethanol (PubChem CID 63518260) has the molecular formula C14H11BrCl2O and a molecular weight of 346.05 g/mol. Its IUPAC name is 2-(4-bromophenyl)-1-(3,5-dichlorophenyl)ethanol.
| Compound Name | 2-(4-bromophenyl)-1-(3,5-dichlorophenyl)ethanol |
|---|---|
| PubChem CID | 63518260 |
| Molecular Formula | C14H11BrCl2O |
| Molecular Weight | 346.05 g/mol |
| Exact Mass | 343.94 |
| IUPAC Name | 2-(4-bromophenyl)-1-(3,5-dichlorophenyl)ethanol |
| SMILES | OC(Cc1ccc(Br)cc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H11BrCl2O/c15-11-3-1-9(2-4-11)5-14(18)10-6-12(16)8-13(17)7-10/h1-4,6-8,14,18H,5H2 |
| InChIKey | MULKQWJCZJKUGF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.05 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |