C9H8BrF3O — CID 25146473
3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol (PubChem CID 25146473) has the molecular formula C9H8BrF3O and a molecular weight of 269.06 g/mol. Its IUPAC name is 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 25146473 |
| Molecular Formula | C9H8BrF3O |
| Molecular Weight | 269.06 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 3-(4-bromophenyl)-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(Cc1ccc(Br)cc1)C(F)(F)F |
| InChI | InChI=1S/C9H8BrF3O/c10-7-3-1-6(2-4-7)5-8(14)9(11,12)13/h1-4,8,14H,5H2 |
| InChIKey | NUQKLBWHNGSIIU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.06 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |