About 1-(chloromethyl)-4-ethenylbenzene;phosphane
1-(chloromethyl)-4-ethenylbenzene;phosphane (PubChem CID 87786462) has the molecular formula C9H12ClP
and a molecular weight of 186.62 g/mol. Its IUPAC name is 1-(chloromethyl)-4-ethenylbenzene;phosphane.
Molecular Properties
| Compound Name | 1-(chloromethyl)-4-ethenylbenzene;phosphane |
| PubChem CID | 87786462 |
| Molecular Formula | C9H12ClP |
| Molecular Weight | 186.62 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 1-(chloromethyl)-4-ethenylbenzene;phosphane |
| SMILES | C=Cc1ccc(CCl)cc1.P |
| InChI | InChI=1S/C9H9Cl.H3P/c1-2-8-3-5-9(7-10)6-4-8;/h2-6H,1,7H2;1H3 |
| InChIKey | STVJRZNSGGMFSU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.62 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-(chloromethyl)-4-ethenylbenzene;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(chloromethyl)-4-ethenylbenzene;phosphane?
The IUPAC name of 1-(chloromethyl)-4-ethenylbenzene;phosphane (CID 87786462) is 1-(chloromethyl)-4-ethenylbenzene;phosphane.
What is the SMILES notation for 1-(chloromethyl)-4-ethenylbenzene;phosphane?
The canonical SMILES for 1-(chloromethyl)-4-ethenylbenzene;phosphane is C=Cc1ccc(CCl)cc1.P.
What is the InChIKey of 1-(chloromethyl)-4-ethenylbenzene;phosphane?
The InChIKey is STVJRZNSGGMFSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl.H3P/c1-2-8-3-5-9(7-10)6-4-8;/h2-6H,1,7H2;1H3.
What are the key properties of 1-(chloromethyl)-4-ethenylbenzene;phosphane?
1-(chloromethyl)-4-ethenylbenzene;phosphane has a molecular weight of 186.62 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(chloromethyl)-4-ethenylbenzene;phosphane is sourced from PubChem (CID 87786462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).