C33H43ClN2O2 — CID 158075036
1-aminopropan-2-ol;1-[bis[(4-ethenylphenyl)methyl]amino]propan-2-ol;1-(chloromethyl)-4-ethenylbenzene (PubChem CID 158075036) has the molecular formula C33H43ClN2O2 and a molecular weight of 535.17 g/mol. Its IUPAC name is 1-aminopropan-2-ol;1-[bis[(4-ethenylphenyl)methyl]amino]propan-2-ol;1-(chloromethyl)-4-ethenylbenzene.
| Compound Name | 1-aminopropan-2-ol;1-[bis[(4-ethenylphenyl)methyl]amino]propan-2-ol;1-(chloromethyl)-4-ethenylbenzene |
|---|---|
| PubChem CID | 158075036 |
| Molecular Formula | C33H43ClN2O2 |
| Molecular Weight | 535.17 g/mol |
| Exact Mass | 534.30 |
| IUPAC Name | 1-aminopropan-2-ol;1-[bis[(4-ethenylphenyl)methyl]amino]propan-2-ol;1-(chloromethyl)-4-ethenylbenzene |
| SMILES | C=Cc1ccc(CCl)cc1.C=Cc1ccc(CN(Cc2ccc(C=C)cc2)CC(C)O)cc1.CC(O)CN |
| InChI | InChI=1S/C21H25NO.C9H9Cl.C3H9NO/c1-4-18-6-10-20(11-7-18)15-22(14-17(3)23)16-21-12-8-19(5-2)9-13-21;1-2-8-3-5-9(7-10)6-4-8;1-3(5)2-4/h4-13,17,23H,1-2,14-16H2,3H3;2-6H,1,7H2;3,5H,2,4H2,1H3 |
| InChIKey | FMGNGGYWHHMDNO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.17 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|