C11H14N2O — CID 91376596
1-[(4-ethenylphenyl)methyl]-1-methylurea (PubChem CID 91376596) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 1-[(4-ethenylphenyl)methyl]-1-methylurea.
| Compound Name | 1-[(4-ethenylphenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 91376596 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 1-[(4-ethenylphenyl)methyl]-1-methylurea |
| SMILES | C=Cc1ccc(CN(C)C(N)=O)cc1 |
| InChI | InChI=1S/C11H14N2O/c1-3-9-4-6-10(7-5-9)8-13(2)11(12)14/h3-7H,1,8H2,2H3,(H2,12,14) |
| InChIKey | QITXTDQCAOIIQG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |