C17H21ClO4 — CID 160615171
1-(chloromethyl)-4-ethenylbenzene;methyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 160615171) has the molecular formula C17H21ClO4 and a molecular weight of 324.80 g/mol. Its IUPAC name is 1-(chloromethyl)-4-ethenylbenzene;methyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | 1-(chloromethyl)-4-ethenylbenzene;methyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 160615171 |
| Molecular Formula | C17H21ClO4 |
| Molecular Weight | 324.80 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 1-(chloromethyl)-4-ethenylbenzene;methyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OC.C=CC(=O)O.C=Cc1ccc(CCl)cc1 |
| InChI | InChI=1S/C9H9Cl.C5H8O2.C3H4O2/c1-2-8-3-5-9(7-10)6-4-8;1-4(2)5(6)7-3;1-2-3(4)5/h2-6H,1,7H2;1H2,2-3H3;2H,1H2,(H,4,5) |
| InChIKey | RFZMRXXXCACALW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.80 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|