About 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene
1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene (PubChem CID 158716634) has the molecular formula C22H25ClO2
and a molecular weight of 356.89 g/mol. Its IUPAC name is 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene.
Molecular Properties
| Compound Name | 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene |
| PubChem CID | 158716634 |
| Molecular Formula | C22H25ClO2 |
| Molecular Weight | 356.89 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OC.C=CC(Cl)c1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C9H9Cl.C8H8.C5H8O2/c1-2-9(10)8-6-4-3-5-7-8;1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h2-7,9H,1H2;2-7H,1H2;1H2,2-3H3 |
| InChIKey | IJJWMRMTRKQBCJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.89 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene?
The IUPAC name of 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene (CID 158716634) is 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene.
What is the SMILES notation for 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene?
The canonical SMILES for 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene is C=C(C)C(=O)OC.C=CC(Cl)c1ccccc1.C=Cc1ccccc1.
What is the InChIKey of 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene?
The InChIKey is IJJWMRMTRKQBCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9Cl.C8H8.C5H8O2/c1-2-9(10)8-6-4-3-5-7-8;1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3/h2-7,9H,1H2;2-7H,1H2;1H2,2-3H3.
What are the key properties of 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene?
1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene has a molecular weight of 356.89 g/mol, XLogP of 6.22, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloroprop-2-enylbenzene;methyl 2-methylprop-2-enoate;styrene is sourced from PubChem (CID 158716634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).