C17H19NO4 — CID 175334987
methyl 2-methylprop-2-enoate;pyrrole-2,5-dione;styrene (PubChem CID 175334987) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;pyrrole-2,5-dione;styrene.
| Compound Name | methyl 2-methylprop-2-enoate;pyrrole-2,5-dione;styrene |
|---|---|
| PubChem CID | 175334987 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl 2-methylprop-2-enoate;pyrrole-2,5-dione;styrene |
| SMILES | C=C(C)C(=O)OC.C=Cc1ccccc1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C8H8.C5H8O2.C4H3NO2/c1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3;6-3-1-2-4(7)5-3/h2-7H,1H2;1H2,2-3H3;1-2H,(H,5,6,7) |
| InChIKey | PWBUTPFJJWIYIU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|