C26H33ClO4 — CID 162191992
1-(chloromethyl)-4-ethenylbenzene;2-ethenoxyethanol;1-(2-ethenoxyethoxymethyl)-4-ethenylbenzene (PubChem CID 162191992) has the molecular formula C26H33ClO4 and a molecular weight of 445.00 g/mol. Its IUPAC name is 1-(chloromethyl)-4-ethenylbenzene;2-ethenoxyethanol;1-(2-ethenoxyethoxymethyl)-4-ethenylbenzene.
| Compound Name | 1-(chloromethyl)-4-ethenylbenzene;2-ethenoxyethanol;1-(2-ethenoxyethoxymethyl)-4-ethenylbenzene |
|---|---|
| PubChem CID | 162191992 |
| Molecular Formula | C26H33ClO4 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 1-(chloromethyl)-4-ethenylbenzene;2-ethenoxyethanol;1-(2-ethenoxyethoxymethyl)-4-ethenylbenzene |
| SMILES | C=COCCO.C=COCCOCc1ccc(C=C)cc1.C=Cc1ccc(CCl)cc1 |
| InChI | InChI=1S/C13H16O2.C9H9Cl.C4H8O2/c1-3-12-5-7-13(8-6-12)11-15-10-9-14-4-2;1-2-8-3-5-9(7-10)6-4-8;1-2-6-4-3-5/h3-8H,1-2,9-11H2;2-6H,1,7H2;2,5H,1,3-4H2 |
| InChIKey | ZQKRERFQWOQZOB-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|