C15H23NO2 — CID 58592129
2-[2-[(4-ethenylphenyl)methoxy]ethoxy]-N,N-dimethylethanamine (PubChem CID 58592129) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-[2-[(4-ethenylphenyl)methoxy]ethoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[2-[(4-ethenylphenyl)methoxy]ethoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 58592129 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-[2-[(4-ethenylphenyl)methoxy]ethoxy]-N,N-dimethylethanamine |
| SMILES | C=Cc1ccc(COCCOCCN(C)C)cc1 |
| InChI | InChI=1S/C15H23NO2/c1-4-14-5-7-15(8-6-14)13-18-12-11-17-10-9-16(2)3/h4-8H,1,9-13H2,2-3H3 |
| InChIKey | BGEXAROTOIRBLU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|