C26H34O3 — CID 68974279
5-(4-ethenylphenyl)-4-[1-(4-ethenylphenyl)-5-hydroxypentan-2-yl]oxypentan-1-ol (PubChem CID 68974279) has the molecular formula C26H34O3 and a molecular weight of 394.56 g/mol. Its IUPAC name is 5-(4-ethenylphenyl)-4-[1-(4-ethenylphenyl)-5-hydroxypentan-2-yl]oxypentan-1-ol.
| Compound Name | 5-(4-ethenylphenyl)-4-[1-(4-ethenylphenyl)-5-hydroxypentan-2-yl]oxypentan-1-ol |
|---|---|
| PubChem CID | 68974279 |
| Molecular Formula | C26H34O3 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | 5-(4-ethenylphenyl)-4-[1-(4-ethenylphenyl)-5-hydroxypentan-2-yl]oxypentan-1-ol |
| SMILES | C=Cc1ccc(CC(CCCO)OC(CCCO)Cc2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C26H34O3/c1-3-21-9-13-23(14-10-21)19-25(7-5-17-27)29-26(8-6-18-28)20-24-15-11-22(4-2)12-16-24/h3-4,9-16,25-28H,1-2,5-8,17-20H2 |
| InChIKey | LTDVTYBKPUGGRN-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |