C14H18O5 — CID 58223580
(2S,3R)-2-hydroxy-3-[3-(4-methylphenyl)propyl]butanedioic acid (PubChem CID 58223580) has the molecular formula C14H18O5 and a molecular weight of 266.29 g/mol. Its IUPAC name is (2S,3R)-2-hydroxy-3-[3-(4-methylphenyl)propyl]butanedioic acid.
| Compound Name | (2S,3R)-2-hydroxy-3-[3-(4-methylphenyl)propyl]butanedioic acid |
|---|---|
| PubChem CID | 58223580 |
| Molecular Formula | C14H18O5 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | (2S,3R)-2-hydroxy-3-[3-(4-methylphenyl)propyl]butanedioic acid |
| SMILES | Cc1ccc(CCC[C@@H](C(=O)O)[C@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C14H18O5/c1-9-5-7-10(8-6-9)3-2-4-11(13(16)17)12(15)14(18)19/h5-8,11-12,15H,2-4H2,1H3,(H,16,17)(H,18,19)/t11-,12+/m1/s1 |
| InChIKey | IPXHZSIQMFMGDE-NEPJUHHUSA-N |
| XLogP | 1.46 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |