About 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid
2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid (PubChem CID 10596555) has the molecular formula C25H26O4
and a molecular weight of 390.48 g/mol. Its IUPAC name is 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid |
| PubChem CID | 10596555 |
| Molecular Formula | C25H26O4 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid |
| SMILES | Cc1ccc(CCCOC(c2ccccc2)(c2ccccc2)C(O)C(=O)O)cc1 |
| InChI | InChI=1S/C25H26O4/c1-19-14-16-20(17-15-19)9-8-18-29-25(23(26)24(27)28,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-7,10-17,23,26H,8-9,18H2,1H3,(H,27,28) |
| InChIKey | HYXVTHMEXLMOON-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid?
The IUPAC name of 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid (CID 10596555) is 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid.
What is the SMILES notation for 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid?
The canonical SMILES for 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid is Cc1ccc(CCCOC(c2ccccc2)(c2ccccc2)C(O)C(=O)O)cc1.
What is the InChIKey of 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid?
The InChIKey is HYXVTHMEXLMOON-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26O4/c1-19-14-16-20(17-15-19)9-8-18-29-25(23(26)24(27)28,21-10-4-2-5-11-21)22-12-6-3-7-13-22/h2-7,10-17,23,26H,8-9,18H2,1H3,(H,27,28).
What are the key properties of 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid?
2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid has a molecular weight of 390.48 g/mol, XLogP of 4.33, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-[3-(4-methylphenyl)propoxy]-3,3-diphenylpropanoic acid is sourced from PubChem (CID 10596555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).