C17H29NO2 — CID 143015850
2-(2-aminoethyl)-3-methyl-5-(4-methylphenyl)pentanoic acid;ethane (PubChem CID 143015850) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is 2-(2-aminoethyl)-3-methyl-5-(4-methylphenyl)pentanoic acid;ethane.
| Compound Name | 2-(2-aminoethyl)-3-methyl-5-(4-methylphenyl)pentanoic acid;ethane |
|---|---|
| PubChem CID | 143015850 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | 2-(2-aminoethyl)-3-methyl-5-(4-methylphenyl)pentanoic acid;ethane |
| SMILES | CC.Cc1ccc(CCC(C)C(CCN)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23NO2.C2H6/c1-11-3-6-13(7-4-11)8-5-12(2)14(9-10-16)15(17)18;1-2/h3-4,6-7,12,14H,5,8-10,16H2,1-2H3,(H,17,18);1-2H3 |
| InChIKey | SZUWIEGRXDHTCZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |