C12H17NO2 — CID 174696804
(3S)-3-amino-5-(4-methylphenyl)pentanoic acid (PubChem CID 174696804) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is (3S)-3-amino-5-(4-methylphenyl)pentanoic acid.
| Compound Name | (3S)-3-amino-5-(4-methylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 174696804 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | (3S)-3-amino-5-(4-methylphenyl)pentanoic acid |
| SMILES | Cc1ccc(CC[C@H](N)CC(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO2/c1-9-2-4-10(5-3-9)6-7-11(13)8-12(14)15/h2-5,11H,6-8,13H2,1H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | ATIYHPKPGNTZKS-NSHDSACASA-N |
| XLogP | 1.73 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |