C17H23N3O5 — CID 123811855
5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-methylphenyl)propanoylamino]-5-oxopentanoic acid (PubChem CID 123811855) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-methylphenyl)propanoylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-methylphenyl)propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 123811855 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 5-[(2-amino-2-oxoethyl)amino]-4-[3-(4-methylphenyl)propanoylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(CCC(=O)NC(CCC(=O)O)C(=O)NCC(N)=O)cc1 |
| InChI | InChI=1S/C17H23N3O5/c1-11-2-4-12(5-3-11)6-8-15(22)20-13(7-9-16(23)24)17(25)19-10-14(18)21/h2-5,13H,6-10H2,1H3,(H2,18,21)(H,19,25)(H,20,22)(H,23,24) |
| InChIKey | SPPRTIRBLUVLSB-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |