C13H16IO7P — CID 67061779
2-[2-(4-iodophenyl)-1-phosphonoethyl]pentanedioic acid (PubChem CID 67061779) has the molecular formula C13H16IO7P and a molecular weight of 442.14 g/mol. Its IUPAC name is 2-[2-(4-iodophenyl)-1-phosphonoethyl]pentanedioic acid.
| Compound Name | 2-[2-(4-iodophenyl)-1-phosphonoethyl]pentanedioic acid |
|---|---|
| PubChem CID | 67061779 |
| Molecular Formula | C13H16IO7P |
| Molecular Weight | 442.14 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | 2-[2-(4-iodophenyl)-1-phosphonoethyl]pentanedioic acid |
| SMILES | O=C(O)CCC(C(=O)O)C(Cc1ccc(I)cc1)P(=O)(O)O |
| InChI | InChI=1S/C13H16IO7P/c14-9-3-1-8(2-4-9)7-11(22(19,20)21)10(13(17)18)5-6-12(15)16/h1-4,10-11H,5-7H2,(H,15,16)(H,17,18)(H2,19,20,21) |
| InChIKey | QNYDXOBBXGFTSX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.14 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|