C9H10INO3 — CID 54355080
(2S)-2-(hydroxyamino)-3-(4-iodophenyl)propanoic acid (PubChem CID 54355080) has the molecular formula C9H10INO3 and a molecular weight of 307.09 g/mol. Its IUPAC name is (2S)-2-(hydroxyamino)-3-(4-iodophenyl)propanoic acid.
| Compound Name | (2S)-2-(hydroxyamino)-3-(4-iodophenyl)propanoic acid |
|---|---|
| PubChem CID | 54355080 |
| Molecular Formula | C9H10INO3 |
| Molecular Weight | 307.09 g/mol |
| Exact Mass | 306.97 |
| IUPAC Name | (2S)-2-(hydroxyamino)-3-(4-iodophenyl)propanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccc(I)cc1)NO |
| InChI | InChI=1S/C9H10INO3/c10-7-3-1-6(2-4-7)5-8(11-14)9(12)13/h1-4,8,11,14H,5H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | UIOAKPCGJOJNDK-QMMMGPOBSA-N |
| XLogP | 1.27 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.09 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|