C11H13IN2O3 — CID 69344480
methyl (2S)-2-(carbamoylamino)-3-(4-iodophenyl)propanoate (PubChem CID 69344480) has the molecular formula C11H13IN2O3 and a molecular weight of 348.14 g/mol. Its IUPAC name is methyl (2S)-2-(carbamoylamino)-3-(4-iodophenyl)propanoate.
| Compound Name | methyl (2S)-2-(carbamoylamino)-3-(4-iodophenyl)propanoate |
|---|---|
| PubChem CID | 69344480 |
| Molecular Formula | C11H13IN2O3 |
| Molecular Weight | 348.14 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | methyl (2S)-2-(carbamoylamino)-3-(4-iodophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(I)cc1)NC(N)=O |
| InChI | InChI=1S/C11H13IN2O3/c1-17-10(15)9(14-11(13)16)6-7-2-4-8(12)5-3-7/h2-5,9H,6H2,1H3,(H3,13,14,16)/t9-/m0/s1 |
| InChIKey | IIZNNLLNZQUQNB-VIFPVBQESA-N |
| XLogP | 1.04 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.14 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|