C12H15IN2O3 — CID 91099689
methyl (2R)-2-(carbamoylamino)-3-[3-(iodomethyl)phenyl]propanoate (PubChem CID 91099689) has the molecular formula C12H15IN2O3 and a molecular weight of 362.17 g/mol. Its IUPAC name is methyl (2R)-2-(carbamoylamino)-3-[3-(iodomethyl)phenyl]propanoate.
| Compound Name | methyl (2R)-2-(carbamoylamino)-3-[3-(iodomethyl)phenyl]propanoate |
|---|---|
| PubChem CID | 91099689 |
| Molecular Formula | C12H15IN2O3 |
| Molecular Weight | 362.17 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | methyl (2R)-2-(carbamoylamino)-3-[3-(iodomethyl)phenyl]propanoate |
| SMILES | COC(=O)[C@@H](Cc1cccc(CI)c1)NC(N)=O |
| InChI | InChI=1S/C12H15IN2O3/c1-18-11(16)10(15-12(14)17)6-8-3-2-4-9(5-8)7-13/h2-5,10H,6-7H2,1H3,(H3,14,15,17)/t10-/m1/s1 |
| InChIKey | VDSMHEPQSNLBJI-SNVBAGLBSA-N |
| XLogP | 1.37 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.17 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|