C14H17NO5 — CID 14334484
methyl 3-(2-acetamido-3-methoxy-3-oxopropyl)benzoate (PubChem CID 14334484) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is methyl 3-(2-acetamido-3-methoxy-3-oxopropyl)benzoate.
| Compound Name | methyl 3-(2-acetamido-3-methoxy-3-oxopropyl)benzoate |
|---|---|
| PubChem CID | 14334484 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | methyl 3-(2-acetamido-3-methoxy-3-oxopropyl)benzoate |
| SMILES | COC(=O)c1cccc(CC(NC(C)=O)C(=O)OC)c1 |
| InChI | InChI=1S/C14H17NO5/c1-9(16)15-12(14(18)20-3)8-10-5-4-6-11(7-10)13(17)19-2/h4-7,12H,8H2,1-3H3,(H,15,16) |
| InChIKey | TYCQOFPEJUFZJU-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |