C12H11F3INO3 — CID 162568507
methyl (2R)-3-(4-iodophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 162568507) has the molecular formula C12H11F3INO3 and a molecular weight of 401.12 g/mol. Its IUPAC name is methyl (2R)-3-(4-iodophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | methyl (2R)-3-(4-iodophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 162568507 |
| Molecular Formula | C12H11F3INO3 |
| Molecular Weight | 401.12 g/mol |
| Exact Mass | 400.97 |
| IUPAC Name | methyl (2R)-3-(4-iodophenyl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1ccc(I)cc1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3INO3/c1-20-10(18)9(17-11(19)12(13,14)15)6-7-2-4-8(16)5-3-7/h2-5,9H,6H2,1H3,(H,17,19)/t9-/m1/s1 |
| InChIKey | GKRQVLQVCCOCRF-SECBINFHSA-N |
| XLogP | 2.05 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.12 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|