C18H16INO3 — CID 175853084
3-(4-iodophenyl)-2-(2-phenylprop-2-enoylamino)propanoic acid (PubChem CID 175853084) has the molecular formula C18H16INO3 and a molecular weight of 421.23 g/mol. Its IUPAC name is 3-(4-iodophenyl)-2-(2-phenylprop-2-enoylamino)propanoic acid.
| Compound Name | 3-(4-iodophenyl)-2-(2-phenylprop-2-enoylamino)propanoic acid |
|---|---|
| PubChem CID | 175853084 |
| Molecular Formula | C18H16INO3 |
| Molecular Weight | 421.23 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | 3-(4-iodophenyl)-2-(2-phenylprop-2-enoylamino)propanoic acid |
| SMILES | C=C(C(=O)NC(Cc1ccc(I)cc1)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C18H16INO3/c1-12(14-5-3-2-4-6-14)17(21)20-16(18(22)23)11-13-7-9-15(19)10-8-13/h2-10,16H,1,11H2,(H,20,21)(H,22,23) |
| InChIKey | RRAOOMFERNLAMA-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.23 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|