C18H22NO5P — CID 19427743
5-(4-phenylphenyl)-4-(phosphonomethylamino)pentanoic acid (PubChem CID 19427743) has the molecular formula C18H22NO5P and a molecular weight of 363.35 g/mol. Its IUPAC name is 5-(4-phenylphenyl)-4-(phosphonomethylamino)pentanoic acid.
| Compound Name | 5-(4-phenylphenyl)-4-(phosphonomethylamino)pentanoic acid |
|---|---|
| PubChem CID | 19427743 |
| Molecular Formula | C18H22NO5P |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 5-(4-phenylphenyl)-4-(phosphonomethylamino)pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccc(-c2ccccc2)cc1)NCP(=O)(O)O |
| InChI | InChI=1S/C18H22NO5P/c20-18(21)11-10-17(19-13-25(22,23)24)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,17,19H,10-13H2,(H,20,21)(H2,22,23,24) |
| InChIKey | JPVMUUFYHNMFHF-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|