C19H23AsNO6P — CID 173256295
3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylarsanyl)propanoyl]amino]propanoic acid (PubChem CID 173256295) has the molecular formula C19H23AsNO6P and a molecular weight of 467.29 g/mol. Its IUPAC name is 3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylarsanyl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylarsanyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 173256295 |
| Molecular Formula | C19H23AsNO6P |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-[[(2S)-3-(4-phenylphenyl)-2-(phosphonomethylarsanyl)propanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)[AsH]CP(=O)(O)O |
| InChI | InChI=1S/C19H23AsNO6P/c22-18(23)10-11-21-19(24)17(20-13-28(25,26)27)12-14-6-8-16(9-7-14)15-4-2-1-3-5-15/h1-9,17,20H,10-13H2,(H,21,24)(H,22,23)(H2,25,26,27)/t17-/m0/s1 |
| InChIKey | RRHUKIVLUXYEGU-KRWDZBQOSA-N |
| XLogP | 1.85 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|