C37H43N2O6P — CID 10371964
3-[[(2S)-2-[bis(4-propan-2-ylphenoxy)phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid (PubChem CID 10371964) has the molecular formula C37H43N2O6P and a molecular weight of 642.73 g/mol. Its IUPAC name is 3-[[(2S)-2-[bis(4-propan-2-ylphenoxy)phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-2-[bis(4-propan-2-ylphenoxy)phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10371964 |
| Molecular Formula | C37H43N2O6P |
| Molecular Weight | 642.73 g/mol |
| Exact Mass | 642.29 |
| IUPAC Name | 3-[[(2S)-2-[bis(4-propan-2-ylphenoxy)phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
| SMILES | CC(C)c1ccc(OP(=O)(CN[C@@H](Cc2ccc(-c3ccccc3)cc2)C(=O)NCCC(=O)O)Oc2ccc(C(C)C)cc2)cc1 |
| InChI | InChI=1S/C37H43N2O6P/c1-26(2)29-14-18-33(19-15-29)44-46(43,45-34-20-16-30(17-21-34)27(3)4)25-39-35(37(42)38-23-22-36(40)41)24-28-10-12-32(13-11-28)31-8-6-5-7-9-31/h5-21,26-27,35,39H,22-25H2,1-4H3,(H,38,42)(H,40,41)/t35-/m0/s1 |
| InChIKey | CKPKKOBFRNMDIP-DHUJRADRSA-N |
| XLogP | 8.00 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.73 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|