C40H53N2O10P — CID 18648109
benzyl 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate (PubChem CID 18648109) has the molecular formula C40H53N2O10P and a molecular weight of 752.84 g/mol. Its IUPAC name is benzyl 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate.
| Compound Name | benzyl 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 18648109 |
| Molecular Formula | C40H53N2O10P |
| Molecular Weight | 752.84 g/mol |
| Exact Mass | 752.34 |
| IUPAC Name | benzyl 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate |
| SMILES | CCC(=O)OC(OP(=O)(CNC(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCC(=O)OCc1ccccc1)O[C@H](OC(=O)CC)C(C)C)C(C)C |
| InChI | InChI=1S/C40H53N2O10P/c1-7-35(43)49-39(28(3)4)51-53(47,52-40(29(5)6)50-36(44)8-2)27-42-34(25-30-19-21-33(22-20-30)32-17-13-10-14-18-32)38(46)41-24-23-37(45)48-26-31-15-11-9-12-16-31/h9-22,28-29,34,39-40,42H,7-8,23-27H2,1-6H3,(H,41,46)/t34?,39-,40?,53?/m0/s1 |
| InChIKey | RPEDPHPPPGLEJY-BDHQFOIMSA-N |
| XLogP | 7.16 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.84 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|