C33H46N2NaO10P — CID 23692081
sodium 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate (PubChem CID 23692081) has the molecular formula C33H46N2NaO10P and a molecular weight of 684.70 g/mol. Its IUPAC name is sodium 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate.
| Compound Name | sodium 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 23692081 |
| Molecular Formula | C33H46N2NaO10P |
| Molecular Weight | 684.70 g/mol |
| Exact Mass | 684.28 |
| IUPAC Name | sodium 3-[[2-[[[(1S)-2-methyl-1-propanoyloxypropoxy]-(2-methyl-1-propanoyloxypropoxy)phosphoryl]methylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate |
| SMILES | CCC(=O)OC(OP(=O)(CNC(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCC(=O)[O-])O[C@H](OC(=O)CC)C(C)C)C(C)C.[Na+] |
| InChI | InChI=1S/C33H47N2O10P.Na/c1-7-29(38)42-32(22(3)4)44-46(41,45-33(23(5)6)43-30(39)8-2)21-35-27(31(40)34-19-18-28(36)37)20-24-14-16-26(17-15-24)25-12-10-9-11-13-25;/h9-17,22-23,27,32-33,35H,7-8,18-21H2,1-6H3,(H,34,40)(H,36,37);/q;+1/p-1/t27?,32-,33?,46?;/m0./s1 |
| InChIKey | XRZRYDQGGARAOY-OVJCUTLZSA-M |
| XLogP | 1.17 |
| TPSA | 169.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.70 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|