C24H31N2O7P — CID 173057185
3-[[2-[[[ethoxycarbonyl(ethyl)amino]-hydroxyphosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid (PubChem CID 173057185) has the molecular formula C24H31N2O7P and a molecular weight of 490.49 g/mol. Its IUPAC name is 3-[[2-[[[ethoxycarbonyl(ethyl)amino]-hydroxyphosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[[[ethoxycarbonyl(ethyl)amino]-hydroxyphosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 173057185 |
| Molecular Formula | C24H31N2O7P |
| Molecular Weight | 490.49 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | 3-[[2-[[[ethoxycarbonyl(ethyl)amino]-hydroxyphosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
| SMILES | CCOC(=O)N(CC)P(=O)(O)CC(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C24H31N2O7P/c1-3-26(24(30)33-4-2)34(31,32)17-21(23(29)25-15-14-22(27)28)16-18-10-12-20(13-11-18)19-8-6-5-7-9-19/h5-13,21H,3-4,14-17H2,1-2H3,(H,25,29)(H,27,28)(H,31,32) |
| InChIKey | FIUIIMCPNWZQRA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.49 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|