C33H47N2O10P — CID 70053133
[2-(2,2-dimethylpropanoyloxy)-1-[2,2-dimethylpropanoyloxymethyl-[1-[(3-ethoxy-3-oxopropyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]ethyl]phosphonic acid (PubChem CID 70053133) has the molecular formula C33H47N2O10P and a molecular weight of 662.72 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoyloxy)-1-[2,2-dimethylpropanoyloxymethyl-[1-[(3-ethoxy-3-oxopropyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]ethyl]phosphonic acid.
| Compound Name | [2-(2,2-dimethylpropanoyloxy)-1-[2,2-dimethylpropanoyloxymethyl-[1-[(3-ethoxy-3-oxopropyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]ethyl]phosphonic acid |
|---|---|
| PubChem CID | 70053133 |
| Molecular Formula | C33H47N2O10P |
| Molecular Weight | 662.72 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | [2-(2,2-dimethylpropanoyloxy)-1-[2,2-dimethylpropanoyloxymethyl-[1-[(3-ethoxy-3-oxopropyl)amino]-1-oxo-3-(4-phenylphenyl)propan-2-yl]amino]ethyl]phosphonic acid |
| SMILES | CCOC(=O)CCNC(=O)C(Cc1ccc(-c2ccccc2)cc1)N(COC(=O)C(C)(C)C)C(COC(=O)C(C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C33H47N2O10P/c1-8-43-28(36)18-19-34-29(37)26(20-23-14-16-25(17-15-23)24-12-10-9-11-13-24)35(22-45-31(39)33(5,6)7)27(46(40,41)42)21-44-30(38)32(2,3)4/h9-17,26-27H,8,18-22H2,1-7H3,(H,34,37)(H2,40,41,42) |
| InChIKey | ZJJMQPZUHHTCAY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.72 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|