C25H27N2O6P — CID 19094339
3-[[3-(4-phenylphenyl)-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]propanoic acid (PubChem CID 19094339) has the molecular formula C25H27N2O6P and a molecular weight of 482.47 g/mol. Its IUPAC name is 3-[[3-(4-phenylphenyl)-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]propanoic acid.
| Compound Name | 3-[[3-(4-phenylphenyl)-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 19094339 |
| Molecular Formula | C25H27N2O6P |
| Molecular Weight | 482.47 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | 3-[[3-(4-phenylphenyl)-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]propanoic acid |
| SMILES | O=C(O)CCNC(=O)C(Cc1ccc(-c2ccccc2)cc1)NC(c1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C25H27N2O6P/c28-23(29)15-16-26-24(30)22(27-25(34(31,32)33)21-9-5-2-6-10-21)17-18-11-13-20(14-12-18)19-7-3-1-4-8-19/h1-14,22,25,27H,15-17H2,(H,26,30)(H,28,29)(H2,31,32,33) |
| InChIKey | PQZZQHHXKPLVOO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|