C31H37N4O9P — CID 25153691
(2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-3-phenyl-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]acetyl]amino]propanoyl]amino]butanoic acid (PubChem CID 25153691) has the molecular formula C31H37N4O9P and a molecular weight of 640.63 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-3-phenyl-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]acetyl]amino]propanoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-3-phenyl-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]acetyl]amino]propanoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 25153691 |
| Molecular Formula | C31H37N4O9P |
| Molecular Weight | 640.63 g/mol |
| Exact Mass | 640.23 |
| IUPAC Name | (2S)-2-[[(2S)-3-(4-hydroxyphenyl)-2-[[2-[[(2S)-3-phenyl-2-[[phenyl(phosphono)methyl]amino]propanoyl]amino]acetyl]amino]propanoyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(c1ccccc1)P(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C31H37N4O9P/c1-2-24(31(40)41)34-29(39)26(18-21-13-15-23(36)16-14-21)33-27(37)19-32-28(38)25(17-20-9-5-3-6-10-20)35-30(45(42,43)44)22-11-7-4-8-12-22/h3-16,24-26,30,35-36H,2,17-19H2,1H3,(H,32,38)(H,33,37)(H,34,39)(H,40,41)(H2,42,43,44)/t24-,25-,26-,30?/m0/s1 |
| InChIKey | KEMIBANQTSZHMS-UENRUGSUSA-N |
| XLogP | 1.59 |
| TPSA | 214.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|