C33H47N2O10P — CID 10100895
3-[[2-[bis[1-(2,2-dimethylpropanoyloxy)ethoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid (PubChem CID 10100895) has the molecular formula C33H47N2O10P and a molecular weight of 662.72 g/mol. Its IUPAC name is 3-[[2-[bis[1-(2,2-dimethylpropanoyloxy)ethoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid.
| Compound Name | 3-[[2-[bis[1-(2,2-dimethylpropanoyloxy)ethoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 10100895 |
| Molecular Formula | C33H47N2O10P |
| Molecular Weight | 662.72 g/mol |
| Exact Mass | 662.30 |
| IUPAC Name | 3-[[2-[bis[1-(2,2-dimethylpropanoyloxy)ethoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoic acid |
| SMILES | CC(OC(=O)C(C)(C)C)OP(=O)(CNC(Cc1ccc(-c2ccccc2)cc1)C(=O)NCCC(=O)O)OC(C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C33H47N2O10P/c1-22(42-30(39)32(3,4)5)44-46(41,45-23(2)43-31(40)33(6,7)8)21-35-27(29(38)34-19-18-28(36)37)20-24-14-16-26(17-15-24)25-12-10-9-11-13-25/h9-17,22-23,27,35H,18-21H2,1-8H3,(H,34,38)(H,36,37) |
| InChIKey | RSKUVYFADDMYAZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.72 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|