C41H59N2O10P — CID 19094329
ethyl 3-[[2-[bis[(1-propanoyloxycyclohexyl)methoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate (PubChem CID 19094329) has the molecular formula C41H59N2O10P and a molecular weight of 770.90 g/mol. Its IUPAC name is ethyl 3-[[2-[bis[(1-propanoyloxycyclohexyl)methoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate.
| Compound Name | ethyl 3-[[2-[bis[(1-propanoyloxycyclohexyl)methoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate |
|---|---|
| PubChem CID | 19094329 |
| Molecular Formula | C41H59N2O10P |
| Molecular Weight | 770.90 g/mol |
| Exact Mass | 770.39 |
| IUPAC Name | ethyl 3-[[2-[bis[(1-propanoyloxycyclohexyl)methoxy]phosphorylmethylamino]-3-(4-phenylphenyl)propanoyl]amino]propanoate |
| SMILES | CCOC(=O)CCNC(=O)C(Cc1ccc(-c2ccccc2)cc1)NCP(=O)(OCC1(OC(=O)CC)CCCCC1)OCC1(OC(=O)CC)CCCCC1 |
| InChI | InChI=1S/C41H59N2O10P/c1-4-36(44)52-40(23-12-8-13-24-40)29-50-54(48,51-30-41(53-37(45)5-2)25-14-9-15-26-41)31-43-35(39(47)42-27-22-38(46)49-6-3)28-32-18-20-34(21-19-32)33-16-10-7-11-17-33/h7,10-11,16-21,35,43H,4-6,8-9,12-15,22-31H2,1-3H3,(H,42,47) |
| InChIKey | PCPYWKIOWRVRON-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 155.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.90 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|