C21H27N2O5P — CID 54260175
3-[[(2S)-2-[[methoxy(2-phenylethyl)phosphoryl]amino]-3-phenylpropanoyl]amino]propanoic acid (PubChem CID 54260175) has the molecular formula C21H27N2O5P and a molecular weight of 418.43 g/mol. Its IUPAC name is 3-[[(2S)-2-[[methoxy(2-phenylethyl)phosphoryl]amino]-3-phenylpropanoyl]amino]propanoic acid.
| Compound Name | 3-[[(2S)-2-[[methoxy(2-phenylethyl)phosphoryl]amino]-3-phenylpropanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54260175 |
| Molecular Formula | C21H27N2O5P |
| Molecular Weight | 418.43 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | 3-[[(2S)-2-[[methoxy(2-phenylethyl)phosphoryl]amino]-3-phenylpropanoyl]amino]propanoic acid |
| SMILES | COP(=O)(CCc1ccccc1)N[C@@H](Cc1ccccc1)C(=O)NCCC(=O)O |
| InChI | InChI=1S/C21H27N2O5P/c1-28-29(27,15-13-17-8-4-2-5-9-17)23-19(16-18-10-6-3-7-11-18)21(26)22-14-12-20(24)25/h2-11,19H,12-16H2,1H3,(H,22,26)(H,23,27)(H,24,25)/t19-,29?/m0/s1 |
| InChIKey | RCYHOERHQHZOJL-KCHZNAQISA-N |
| XLogP | 2.86 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.43 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|