C22H27NO5P+ — CID 22161457
[1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium (PubChem CID 22161457) has the molecular formula C22H27NO5P+ and a molecular weight of 416.43 g/mol. Its IUPAC name is [1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium.
| Compound Name | [1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium |
|---|---|
| PubChem CID | 22161457 |
| Molecular Formula | C22H27NO5P+ |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | [1-(2-carboxyethylamino)-1-oxo-3-phenylpropan-2-yl]oxy-oxo-(4-phenylbutyl)phosphanium |
| SMILES | O=C(O)CCNC(=O)C(Cc1ccccc1)O[P+](=O)CCCCc1ccccc1 |
| InChI | InChI=1S/C22H26NO5P/c24-21(25)14-15-23-22(26)20(17-19-12-5-2-6-13-19)28-29(27)16-8-7-11-18-9-3-1-4-10-18/h1-6,9-10,12-13,20H,7-8,11,14-17H2,(H-,23,24,25,26)/p+1 |
| InChIKey | KENAVXHJMVWURF-UHFFFAOYSA-O |
| XLogP | 3.97 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|